Type: Neutral
Formula: C14H19NO5S
SMILES: |
S(=O)(=O)(NCC(C(CC)C=O)C(O)=O)c1ccc(cc1)C |
InChI: |
InChI=1/C14H19NO5S/c1-3-11(9-16)13(14(17)18)8-15-21(19,20)12-6-4-10(2)5-7-12/h4-7,9,11,13,15H,3,8H2,1-2H3,(H,17,18)/t11-,13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 313.374 g/mol | logS: -2.08056 | SlogP: 1.19922 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.129823 | Sterimol/B1: 2.68813 | Sterimol/B2: 3.43777 | Sterimol/B3: 5.25927 |
Sterimol/B4: 6.58012 | Sterimol/L: 15.4677 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 538.816 | Positive charged surface: 304.234 | Negative charged surface: 234.581 | Volume: 280.25 |
Hydrophobic surface: 328.005 | Hydrophilic surface: 210.811 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules
|