 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C(C)(C)C(NC1C(NC(=O)Cc1ccccc1)C(=O)NCc1ccccc1)C(O)=O |
| InChI: | InChI=1/C23H27N3O4S/c1-23(2)19(22(29)30)26-21(31-23)18(20(28)24-14-16-11-7-4-8-12-16)25-17(27)13-15-9-5-3-6-10-15/h3-12,18-19,21,26H,13-14H2,1-2H3,(H,24,28)(H,25,27)(H,29,30)/t18-,19-,21+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=121.334 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 441.552 g/mol | logS: -4.9716 | SlogP: 2.19097 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0941253 | Sterimol/B1: 2.40728 | Sterimol/B2: 2.71711 | Sterimol/B3: 5.80255 | |||
| Sterimol/B4: 9.16873 | Sterimol/L: 18.8647 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 728.091 | Positive charged surface: 426.945 | Negative charged surface: 301.146 | Volume: 416.25 | |||
| Hydrophobic surface: 523.571 | Hydrophilic surface: 204.52 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
