 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2cnc(C(=O)NC(CC(=O)[O-])C(=O)[O-])c2N)C(O)C1O)(=O) ([O-])[O-] |
| InChI: | InChI=1/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/p-4/t4-,5-,8+,9-,12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=82.9772 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 450.253 g/mol | logS: -0.10401 | SlogP: -8.0566 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.067547 | Sterimol/B1: 2.87588 | Sterimol/B2: 3.79554 | Sterimol/B3: 4.75933 | |||
| Sterimol/B4: 5.55058 | Sterimol/L: 18.4848 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 637.626 | Positive charged surface: 289.011 | Negative charged surface: 348.616 | Volume: 332.375 | |||
| Hydrophobic surface: 167.691 | Hydrophilic surface: 469.935 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 7 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
