Type: Neutral
Formula: C6H11N2O6P
SMILES: |
P(OCC(O)C(O)c1[nH]cnc1)(O)(O)=O |
InChI: |
InChI=1/C6H11N2O6P/c9-5(2-14-15(11,12)13)6(10)4-1-7-3-8-4/h1,3,5-6,9-10H,2H2,(H,7,8)(H2,11,12,13)/t5-,6+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 238.136 g/mol | logS: 0.70446 | SlogP: -2.0614 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0729541 | Sterimol/B1: 2.55515 | Sterimol/B2: 2.78724 | Sterimol/B3: 3.67023 |
Sterimol/B4: 4.36603 | Sterimol/L: 13.7347 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 417.697 | Positive charged surface: 268.467 | Negative charged surface: 149.23 | Volume: 184.625 |
Hydrophobic surface: 145.491 | Hydrophilic surface: 272.206 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|