Type: Ionized
Formula: C7H8O7-2
SMILES: |
OC(C(CC(O)=O)C(=O)[O-])(C(=O)[O-])C |
InChI: |
InChI=1/C7H10O7/c1-7(14,6(12)13)3(5(10)11)2-4(8)9/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/p-2/t3-,7-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 204.134 g/mol | logS: 0.13797 | SlogP: -3.6719 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.203605 | Sterimol/B1: 2.15608 | Sterimol/B2: 3.32922 | Sterimol/B3: 3.70798 |
Sterimol/B4: 5.47054 | Sterimol/L: 10.7925 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 345.757 | Positive charged surface: 143.149 | Negative charged surface: 202.608 | Volume: 157.25 |
Hydrophobic surface: 80.1966 | Hydrophilic surface: 265.5604 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 4 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|