 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | SC1C(OC2NC=3NC(=NC(=O)C=3NC2C1=S)N)COP(=O)([O-])[O-] |
| InChI: | InChI=1/C10H14N5O6PS2/c11-10-14-7-4(8(16)15-10)12-3-6(24)5(23)2(21-9(3)13-7)1-20-22(17,18)19/h2-3,5,9,12,23H,1H2,(H2,17,18,19)(H4,11,13,14,15,16)/p-2/t2-,3-,5+,9+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=43.4277 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 393.341 g/mol | logS: -3.19022 | SlogP: -4.6703 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0635848 | Sterimol/B1: 3.70092 | Sterimol/B2: 4.40461 | Sterimol/B3: 5.29894 | |||
| Sterimol/B4: 5.46613 | Sterimol/L: 15.2014 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 552.142 | Positive charged surface: 260.24 | Negative charged surface: 291.902 | Volume: 287 | |||
| Hydrophobic surface: 97.7965 | Hydrophilic surface: 454.3455 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
