Type: Neutral
Formula: C6H11O10P
SMILES: |
P(OCC(O)C(O)C(=O)C(O)C(O)=O)(O)(O)=O |
InChI: |
InChI=1/C6H11O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h2-3,5,7-8,10H,1H2,(H,11,12)(H2,13,14,15)/t2-,3-,5+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.118 g/mol | logS: 1.10485 | SlogP: -4.2381 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.101484 | Sterimol/B1: 2.88382 | Sterimol/B2: 3.53858 | Sterimol/B3: 3.82664 |
Sterimol/B4: 3.97378 | Sterimol/L: 14.0647 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 442.018 | Positive charged surface: 232.292 | Negative charged surface: 209.726 | Volume: 194.25 |
Hydrophobic surface: 50.5905 | Hydrophilic surface: 391.4275 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|