 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NCC1CCC([NH3+])CC1)C1N(CCC1)C(=O)C(NC)Cc1ccccc1 |
| InChI: | InChI=1/C22H34N4O2/c1-24-19(14-16-6-3-2-4-7-16)22(28)26-13-5-8-20(26)21(27)25-15-17-9-11-18(23)12-10-17/h2-4,6-7,17-20,24H,5,8-15,23H2,1H3,(H,25,27)/p+1/t17-,18+,19-,20+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=67.4283 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 387.548 g/mol | logS: -2.6776 | SlogP: 0.72497 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0690977 | Sterimol/B1: 2.14287 | Sterimol/B2: 4.12546 | Sterimol/B3: 5.9641 | |||
| Sterimol/B4: 7.65494 | Sterimol/L: 19.1697 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 696.545 | Positive charged surface: 530.176 | Negative charged surface: 166.369 | Volume: 405.875 | |||
| Hydrophobic surface: 581.273 | Hydrophilic surface: 115.272 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
