 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1CC(NC(CCc2ccccc2)C(OCC)=O)C(=O)N(CC1c1sccc1)CC(=O)[O-] |
| InChI: | InChI=1/C23H28N2O5S2/c1-2-30-23(29)17(11-10-16-7-4-3-5-8-16)24-18-15-32-20(19-9-6-12-31-19)13-25(22(18)28)14-21(26)27/h3-9,12,17-18,20,24H,2,10-11,13-15H2,1H3,(H,26,27)/p-1/t17-,18-,20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.792 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 475.61 g/mol | logS: -5.16216 | SlogP: 1.73267 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0797795 | Sterimol/B1: 2.56435 | Sterimol/B2: 3.07935 | Sterimol/B3: 5.62041 | |||
| Sterimol/B4: 11.5016 | Sterimol/L: 20.402 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 768.855 | Positive charged surface: 437.093 | Negative charged surface: 331.762 | Volume: 442.75 | |||
| Hydrophobic surface: 592.74 | Hydrophilic surface: 176.115 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
