 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2n3c4c(c5c(CNC5=O)c5c6c(n(c45)C1(C)C(OC)C(O)C2O)cccc6)c1c 3cccc1 |
| InChI: | InChI=1/C27H23N3O5/c1-27-24(34-2)22(31)23(32)26(35-27)29-15-9-5-3-7-12(15)18-19-14(11-28-25(19)33)17-13-8-4-6-10-16(13)30(27)21(17)20(18)29/h3-10,22-24,26,31-32H,11H2,1-2H3,(H,28,33)/t22-,23+,24+,26+,27-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=165.247 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 469.497 g/mol | logS: -6.15637 | SlogP: 3.7711 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.128335 | Sterimol/B1: 2.17387 | Sterimol/B2: 4.89247 | Sterimol/B3: 6.11925 | |||
| Sterimol/B4: 7.95438 | Sterimol/L: 15.1477 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 635.499 | Positive charged surface: 407.806 | Negative charged surface: 205.953 | Volume: 415.875 | |||
| Hydrophobic surface: 454.417 | Hydrophilic surface: 181.082 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
