 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1cc(n(c1)C)C(=O)NCCC(=[NH2+])N)C=1N(CC(=N)C=1)C |
| InChI: | InChI=1/C15H21N7O2/c1-21-7-9(16)5-11(21)15(24)20-10-6-12(22(2)8-10)14(23)19-4-3-13(17)18/h5-6,8,16H,3-4,7H2,1-2H3,(H3,17,18)(H,19,23)(H,20,24)/p+1/b16-9+ |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=18.7358 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 332.388 g/mol | logS: -1.71031 | SlogP: -1.59193 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0265091 | Sterimol/B1: 2.14835 | Sterimol/B2: 2.22573 | Sterimol/B3: 4.23049 | |||
| Sterimol/B4: 8.22039 | Sterimol/L: 18.9401 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 617.281 | Positive charged surface: 481.797 | Negative charged surface: 135.484 | Volume: 317.5 | |||
| Hydrophobic surface: 348.581 | Hydrophilic surface: 268.7 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 2 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
