 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(C1CCCCC1)c1ccccc1)C([NH2+]CCC)C |
| InChI: | InChI=1/C19H30N2O/c1-3-14-20-15(2)19(22)21-18(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4,6-7,10-11,15,17-18,20H,3,5,8-9,12-14H2,1-2H3,(H,21,22)/p+1/t15-,18+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=37.6041 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 303.47 g/mol | logS: -4.30412 | SlogP: 2.8816 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0800115 | Sterimol/B1: 3.55244 | Sterimol/B2: 3.73505 | Sterimol/B3: 5.12539 | |||
| Sterimol/B4: 7.3732 | Sterimol/L: 16.04 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 618.256 | Positive charged surface: 456.088 | Negative charged surface: 162.168 | Volume: 338.875 | |||
| Hydrophobic surface: 531.625 | Hydrophilic surface: 86.631 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
