Type: Neutral
Formula: C20H18FN3O
SMILES: |
Fc1ccccc1NC(=O)Nc1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C20H18FN3O/c21-15-9-3-6-12-18(15)23-20(25)24-19-13-7-1-4-10-16(13)22-17-11-5-2-8-14(17)19/h1,3-4,6-7,9-10,12H,2,5,8,11H2,(H2,22,23,24,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 335.382 g/mol | logS: -5.22438 | SlogP: 4.89664 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0965795 | Sterimol/B1: 2.55743 | Sterimol/B2: 3.80212 | Sterimol/B3: 4.24283 |
Sterimol/B4: 9.69679 | Sterimol/L: 15.2956 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 568.649 | Positive charged surface: 349.243 | Negative charged surface: 213.837 | Volume: 312.375 |
Hydrophobic surface: 510.656 | Hydrophilic surface: 57.993 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |