 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(N)C(NC(=O)C([NH3+])C(CC)C)Cc1ccccc1 |
| InChI: | InChI=1/C15H23N3O2/c1-3-10(2)13(16)15(20)18-12(14(17)19)9-11-7-5-4-6-8-11/h4-8,10,12-13H,3,9,16H2,1-2H3,(H2,17,19)(H,18,20)/p+1/t10-,12-,13+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=48.667 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 278.376 g/mol | logS: -2.78398 | SlogP: -0.14423 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.218331 | Sterimol/B1: 2.73823 | Sterimol/B2: 4.99899 | Sterimol/B3: 5.1126 | |||
| Sterimol/B4: 6.45663 | Sterimol/L: 12.2191 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 506.793 | Positive charged surface: 356.822 | Negative charged surface: 149.972 | Volume: 291.5 | |||
| Hydrophobic surface: 305.764 | Hydrophilic surface: 201.029 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
