Type: Neutral
Formula: C15H19FN2O2
SMILES: |
Fc1cc(NC(=O)C(=O)NC2CCCCC2C)ccc1 |
InChI: |
InChI=1/C15H19FN2O2/c1-10-5-2-3-8-13(10)18-15(20)14(19)17-12-7-4-6-11(16)9-12/h4,6-7,9-10,13H,2-3,5,8H2,1H3,(H,17,19)(H,18,20)/t10-,13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 278.327 g/mol | logS: -3.72743 | SlogP: 2.4591 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0343035 | Sterimol/B1: 2.327 | Sterimol/B2: 2.55816 | Sterimol/B3: 3.70862 |
Sterimol/B4: 6.37182 | Sterimol/L: 16.5859 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 514.71 | Positive charged surface: 326.452 | Negative charged surface: 188.258 | Volume: 267 |
Hydrophobic surface: 413.4 | Hydrophilic surface: 101.31 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |