Type: Neutral
Formula: C14H19N3O5
SMILES: |
OC(=O)C(NC(=O)C(NC(=O)CN)CO)Cc1ccccc1 |
InChI: |
InChI=1/C14H19N3O5/c15-7-12(19)16-11(8-18)13(20)17-10(14(21)22)6-9-4-2-1-3-5-9/h1-5,10-11,18H,6-8,15H2,(H,16,19)(H,17,20)(H,21,22)/t10-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 309.322 g/mol | logS: -1.24971 | SlogP: -1.76573 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.125801 | Sterimol/B1: 2.56328 | Sterimol/B2: 3.58932 | Sterimol/B3: 3.60777 |
Sterimol/B4: 9.12597 | Sterimol/L: 14.1092 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 556.215 | Positive charged surface: 369.781 | Negative charged surface: 186.433 | Volume: 283.5 |
Hydrophobic surface: 304.375 | Hydrophilic surface: 251.84 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |