 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CNC(=O)C1c2c(cccc2)C(=O)N(C)C1c1c2c(n(c1)C)cccc2 |
| InChI: | InChI=1/C25H27N3O3/c1-27-15-20(17-9-5-6-12-21(17)27)23-22(24(29)26-14-16-8-7-13-31-16)18-10-3-4-11-19(18)25(30)28(23)2/h3-6,9-12,15-16,22-23H,7-8,13-14H2,1-2H3,(H,26,29)/t16-,22+,23-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=91.4002 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 417.509 g/mol | logS: -4.30285 | SlogP: 3.8387 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.16183 | Sterimol/B1: 4.05183 | Sterimol/B2: 4.58413 | Sterimol/B3: 6.25182 | |||
| Sterimol/B4: 7.59386 | Sterimol/L: 17.246 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 696.553 | Positive charged surface: 498.318 | Negative charged surface: 194.307 | Volume: 409.125 | |||
| Hydrophobic surface: 634.559 | Hydrophilic surface: 61.994 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.