Type: Neutral
Formula: C22H22N2O
SMILES: |
O=C(Nc1ccc(cc1)CC)c1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C22H22N2O/c1-2-15-11-13-16(14-12-15)23-22(25)21-17-7-3-5-9-19(17)24-20-10-6-4-8-18(20)21/h3,5,7,9,11-14H,2,4,6,8,10H2,1H3,(H,23,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 330.431 g/mol | logS: -6.02136 | SlogP: 4.92821 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.049648 | Sterimol/B1: 2.47883 | Sterimol/B2: 4.46629 | Sterimol/B3: 6.03333 |
Sterimol/B4: 6.17836 | Sterimol/L: 16.3271 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 601.864 | Positive charged surface: 377.493 | Negative charged surface: 219.65 | Volume: 337 |
Hydrophobic surface: 528.099 | Hydrophilic surface: 73.765 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |