Type: Neutral
Formula: C21H26BrNO2
SMILES: |
Brc1cc(C(CC(=O)NCCCCCC)c2ccccc2)c(O)cc1 |
InChI: |
InChI=1/C21H26BrNO2/c1-2-3-4-8-13-23-21(25)15-18(16-9-6-5-7-10-16)19-14-17(22)11-12-20(19)24/h5-7,9-12,14,18,24H,2-4,8,13,15H2,1H3,(H,23,25)/t18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 404.348 g/mol | logS: -5.91994 | SlogP: 5.3732 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0728791 | Sterimol/B1: 3.85047 | Sterimol/B2: 4.66735 | Sterimol/B3: 5.138 |
Sterimol/B4: 6.95264 | Sterimol/L: 19.4112 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 684.84 | Positive charged surface: 419.93 | Negative charged surface: 264.91 | Volume: 375 |
Hydrophobic surface: 586.868 | Hydrophilic surface: 97.972 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |