Type: Neutral
Formula: C13H18O4S
SMILES: |
S(O)(=O)(=O)C(C1(O)CCCCC1)c1ccccc1 |
InChI: |
InChI=1/C13H18O4S/c14-13(9-5-2-6-10-13)12(18(15,16)17)11-7-3-1-4-8-11/h1,3-4,7-8,12,14H,2,5-6,9-10H2,(H,15,16,17)/t12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 270.349 g/mol | logS: -2.64759 | SlogP: 1.8405 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.212709 | Sterimol/B1: 3.3198 | Sterimol/B2: 3.4363 | Sterimol/B3: 4.25069 |
Sterimol/B4: 6.18394 | Sterimol/L: 12.0782 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 444.696 | Positive charged surface: 277.967 | Negative charged surface: 166.729 | Volume: 241.625 |
Hydrophobic surface: 335.72 | Hydrophilic surface: 108.976 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|