 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N)c1ccc(NC(=O)C(NC(=O)C)Cc2ccccc2)cc1 |
| InChI: | InChI=1/C17H19N3O4S/c1-12(21)19-16(11-13-5-3-2-4-6-13)17(22)20-14-7-9-15(10-8-14)25(18,23)24/h2-10,16H,11H2,1H3,(H,19,21)(H,20,22)(H2,18,23,24)/t16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=71.3197 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 361.422 g/mol | logS: -3.82288 | SlogP: 1.01987 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0332709 | Sterimol/B1: 2.11585 | Sterimol/B2: 2.90191 | Sterimol/B3: 3.50472 | |||
| Sterimol/B4: 8.56212 | Sterimol/L: 18.3548 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 605.31 | Positive charged surface: 333.605 | Negative charged surface: 271.705 | Volume: 323 | |||
| Hydrophobic surface: 407.601 | Hydrophilic surface: 197.709 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
