 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C(O)C(O)C[NH3+])C(NC(=O)C)C([NH3+])C=C1C(=O)[O-] |
| InChI: | InChI=1/C11H19N3O6/c1-4(15)14-8-5(13)2-7(11(18)19)20-10(8)9(17)6(16)3-12/h2,5-6,8-10,16-17H,3,12-13H2,1H3,(H,14,15)(H,18,19)/p+1/t5-,6-,8+,9-,10+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=22.4085 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 290.296 g/mol | logS: 0.30331 | SlogP: -5.9021 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0607144 | Sterimol/B1: 2.18446 | Sterimol/B2: 2.52748 | Sterimol/B3: 3.43116 | |||
| Sterimol/B4: 9.36005 | Sterimol/L: 12.9597 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 489.448 | Positive charged surface: 349.231 | Negative charged surface: 140.217 | Volume: 254.75 | |||
| Hydrophobic surface: 198.404 | Hydrophilic surface: 291.044 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 2 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
