 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1c2c(nccc2)cc1S(=O)(=O)NC1CCN(Cc2cc(ccc2O)C(=[NH2+])N)C1=O |
| InChI: | InChI=1/C19H19N5O4S2/c20-18(21)11-3-4-15(25)12(8-11)10-24-7-5-13(19(24)26)23-30(27,28)17-9-14-16(29-17)2-1-6-22-14/h1-4,6,8-9,13,23,25H,5,7,10H2,(H3,20,21)/p+1/t13-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=23.4537 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 446.532 g/mol | logS: -3.99684 | SlogP: -0.1879 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.130608 | Sterimol/B1: 2.34049 | Sterimol/B2: 4.82098 | Sterimol/B3: 5.50591 | |||
| Sterimol/B4: 7.10212 | Sterimol/L: 18.4203 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 695.117 | Positive charged surface: 434.685 | Negative charged surface: 260.432 | Volume: 381.375 | |||
| Hydrophobic surface: 391.967 | Hydrophilic surface: 303.15 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 2 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
