 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(N(CN(C(=O)c1ccccc1)CCCC(O)=O)C=1NCCN=1)CCC |
| InChI: | InChI=1/C19H28N4O4/c1-2-7-16(24)23(19-20-11-12-21-19)14-22(13-6-10-17(25)26)18(27)15-8-4-3-5-9-15/h3-5,8-9,16,24H,2,6-7,10-14H2,1H3,(H,20,21)(H,25,26)/t16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=33.2438 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 376.457 g/mol | logS: -2.08385 | SlogP: 1.3308 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.302279 | Sterimol/B1: 2.4293 | Sterimol/B2: 3.47566 | Sterimol/B3: 6.02487 | |||
| Sterimol/B4: 9.52379 | Sterimol/L: 15.1339 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 643.602 | Positive charged surface: 448.736 | Negative charged surface: 194.866 | Volume: 365.25 | |||
| Hydrophobic surface: 446.438 | Hydrophilic surface: 197.164 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
