 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(CC)CN(CN(C(=O)c1ccccc1)CCCC(O)=O)C=1NCCN=1 |
| InChI: | InChI=1/C19H28N4O4/c1-2-16(24)13-23(19-20-10-11-21-19)14-22(12-6-9-17(25)26)18(27)15-7-4-3-5-8-15/h3-5,7-8,16,24H,2,6,9-14H2,1H3,(H,20,21)(H,25,26)/t16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=55.3314 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 376.457 g/mol | logS: -1.6879 | SlogP: 0.9832 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.14056 | Sterimol/B1: 2.98856 | Sterimol/B2: 4.91473 | Sterimol/B3: 6.21149 | |||
| Sterimol/B4: 7.57769 | Sterimol/L: 15.4146 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 644.704 | Positive charged surface: 446.732 | Negative charged surface: 197.973 | Volume: 366 | |||
| Hydrophobic surface: 434.476 | Hydrophilic surface: 210.228 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
