Type: Ionized
Formula: C6H8O8P-3
SMILES: |
P(=O)([O-])(C(O)(C(=O)[O-])C)C(O)(C(=O)[O-])C |
InChI: |
InChI=1/C6H11O8P/c1-5(11,3(7)8)15(13,14)6(2,12)4(9)10/h11-12H,1-2H3,(H,7,8)(H,9,10)(H,13,14)/p-3/t5-,6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 239.096 g/mol | logS: 0.043 | SlogP: -5.5286 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.29842 | Sterimol/B1: 2.27967 | Sterimol/B2: 2.472 | Sterimol/B3: 4.47659 |
Sterimol/B4: 4.7248 | Sterimol/L: 10.4275 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 356.522 | Positive charged surface: 134.972 | Negative charged surface: 221.549 | Volume: 171.875 |
Hydrophobic surface: 79.3476 | Hydrophilic surface: 277.1744 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 6 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|