Type: Neutral
Formula: C21H21N3O
SMILES: |
O=C(Nc1c2CCCCCc2nc2c1cccc2)Nc1ccccc1 |
InChI: |
InChI=1/C21H21N3O/c25-21(22-15-9-3-1-4-10-15)24-20-16-11-5-2-6-13-18(16)23-19-14-8-7-12-17(19)20/h1,3-4,7-10,12,14H,2,5-6,11,13H2,(H2,22,23,24,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 331.419 g/mol | logS: -5.44462 | SlogP: 5.14764 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.104657 | Sterimol/B1: 3.28217 | Sterimol/B2: 4.47863 | Sterimol/B3: 6.32176 |
Sterimol/B4: 6.37664 | Sterimol/L: 15.2292 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 580.888 | Positive charged surface: 365.215 | Negative charged surface: 211.242 | Volume: 325.625 |
Hydrophobic surface: 523.047 | Hydrophilic surface: 57.841 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |