Type: Neutral
Formula: C19H18Cl2N2O5S
SMILES: |
Clc1cc(ccc1Cl)C(=O)Nc1ccccc1S(=O)(=O)N1CCCC1C(OC)=O |
InChI: |
InChI=1/C19H18Cl2N2O5S/c1-28-19(25)16-6-4-10-23(16)29(26,27)17-7-3-2-5-15(17)22-18(24)12-8-9-13(20)14(21)11-12/h2-3,5,7-9,11,16H,4,6,10H2,1H3,(H,22,24)/t16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 457.334 g/mol | logS: -5.69756 | SlogP: 3.5718 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.131064 | Sterimol/B1: 3.20142 | Sterimol/B2: 4.02797 | Sterimol/B3: 4.89623 |
Sterimol/B4: 8.91994 | Sterimol/L: 16.6191 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 635.241 | Positive charged surface: 320.555 | Negative charged surface: 314.686 | Volume: 374.125 |
Hydrophobic surface: 546.012 | Hydrophilic surface: 89.229 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |