Type: Neutral
Formula: C19H23NO3S
SMILES: |
s1cccc1C(N1CCCCC1C(O)=O)c1ccc(OCC)cc1 |
InChI: |
InChI=1/C19H23NO3S/c1-2-23-15-10-8-14(9-11-15)18(17-7-5-13-24-17)20-12-4-3-6-16(20)19(21)22/h5,7-11,13,16,18H,2-4,6,12H2,1H3,(H,21,22)/t16-,18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 345.463 g/mol | logS: -3.95848 | SlogP: 4.2708 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.194214 | Sterimol/B1: 4.26017 | Sterimol/B2: 4.38869 | Sterimol/B3: 5.45132 |
Sterimol/B4: 6.53855 | Sterimol/L: 14.5417 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 587.875 | Positive charged surface: 371.693 | Negative charged surface: 216.182 | Volume: 332.375 |
Hydrophobic surface: 480.667 | Hydrophilic surface: 107.208 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |