Type: Neutral
Formula: C19H20ClN3O2
SMILES: |
Clc1ccc(NC(=O)N2C3CC(O)(CC2CC3)c2cccnc2)cc1 |
InChI: |
InChI=1/C19H20ClN3O2/c20-14-3-5-15(6-4-14)22-18(24)23-16-7-8-17(23)11-19(25,10-16)13-2-1-9-21-12-13/h1-6,9,12,16-17,25H,7-8,10-11H2,(H,22,24)/t16-,17+,19- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 357.841 g/mol | logS: -3.46847 | SlogP: 4.093 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0916181 | Sterimol/B1: 3.00559 | Sterimol/B2: 3.77398 | Sterimol/B3: 4.13802 |
Sterimol/B4: 5.3584 | Sterimol/L: 18.008 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 558.705 | Positive charged surface: 330.98 | Negative charged surface: 227.725 | Volume: 321.125 |
Hydrophobic surface: 467.146 | Hydrophilic surface: 91.559 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |