Type: Neutral
Formula: C20H18ClN3O3S
SMILES: |
Clc1ccc(nc1)NC(=O)C1N(S(=O)(=O)c2cc3c(cc2)cccc3)CCC1 |
InChI: |
InChI=1/C20H18ClN3O3S/c21-16-8-10-19(22-13-16)23-20(25)18-6-3-11-24(18)28(26,27)17-9-7-14-4-1-2-5-15(14)12-17/h1-2,4-5,7-10,12-13,18H,3,6,11H2,(H,22,23,25)/t18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 415.901 g/mol | logS: -5.51254 | SlogP: 3.68 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0822109 | Sterimol/B1: 3.05314 | Sterimol/B2: 3.63243 | Sterimol/B3: 5.00651 |
Sterimol/B4: 8.62796 | Sterimol/L: 17.6857 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 635.58 | Positive charged surface: 336.581 | Negative charged surface: 288.221 | Volume: 359.625 |
Hydrophobic surface: 545.283 | Hydrophilic surface: 90.297 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |