Type: Neutral
Formula: C21H27N3O2
SMILES: |
O=C1N2C(=NC(=C1)C(CC)C(=O)NCCc1ccccc1)CCCCC2 |
InChI: |
InChI=1/C21H27N3O2/c1-2-17(21(26)22-13-12-16-9-5-3-6-10-16)18-15-20(25)24-14-8-4-7-11-19(24)23-18/h3,5-6,9-10,15,17H,2,4,7-8,11-14H2,1H3,(H,22,26)/t17-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 353.466 g/mol | logS: -4.09633 | SlogP: 3.07007 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0795171 | Sterimol/B1: 2.23578 | Sterimol/B2: 3.3613 | Sterimol/B3: 5.10487 |
Sterimol/B4: 9.44452 | Sterimol/L: 17.1713 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 649.669 | Positive charged surface: 443.368 | Negative charged surface: 206.301 | Volume: 358 |
Hydrophobic surface: 552.704 | Hydrophilic surface: 96.965 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |