Type: Neutral
Formula: C20H18ClN3O3S
SMILES: |
Clc1ccc(nc1)NC(=O)C1N(S(=O)(=O)c2c3c(ccc2)cccc3)CCC1 |
InChI: |
InChI=1/C20H18ClN3O3S/c21-15-10-11-19(22-13-15)23-20(25)17-8-4-12-24(17)28(26,27)18-9-3-6-14-5-1-2-7-16(14)18/h1-3,5-7,9-11,13,17H,4,8,12H2,(H,22,23,25)/t17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 415.901 g/mol | logS: -5.51254 | SlogP: 3.68 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.163334 | Sterimol/B1: 2.3726 | Sterimol/B2: 3.32965 | Sterimol/B3: 5.45793 |
Sterimol/B4: 8.32096 | Sterimol/L: 17.3517 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 631.886 | Positive charged surface: 334.913 | Negative charged surface: 288.784 | Volume: 360.5 |
Hydrophobic surface: 547.169 | Hydrophilic surface: 84.717 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |