Type: Neutral
Formula: C9H17NO6
SMILES: |
O1C(CO)C(O)C(O)C(O)C1NC(=O)CC |
InChI: |
InChI=1/C9H17NO6/c1-2-5(12)10-9-8(15)7(14)6(13)4(3-11)16-9/h4,6-9,11,13-15H,2-3H2,1H3,(H,10,12)/t4-,6+,7+,8+,9+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 235.236 g/mol | logS: 0.66571 | SlogP: -2.6875 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.148116 | Sterimol/B1: 3.11254 | Sterimol/B2: 3.69587 | Sterimol/B3: 4.7714 |
Sterimol/B4: 5.36122 | Sterimol/L: 12.377 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 438.638 | Positive charged surface: 330.581 | Negative charged surface: 108.057 | Volume: 205.5 |
Hydrophobic surface: 205.647 | Hydrophilic surface: 232.991 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |