 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1CC(N(C(=O)C)C1c1cccc(CC=C)c1O)C(=O)[O-] |
| InChI: | InChI=1/C15H17NO4S/c1-3-5-10-6-4-7-11(13(10)18)14-16(9(2)17)12(8-21-14)15(19)20/h3-4,6-7,12,14,18H,1,5,8H2,2H3,(H,19,20)/p-1/t12-,14+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=50.2091 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 306.362 g/mol | logS: -3.50633 | SlogP: 0.92857 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.158683 | Sterimol/B1: 2.5597 | Sterimol/B2: 3.51274 | Sterimol/B3: 4.91763 | |||
| Sterimol/B4: 6.80347 | Sterimol/L: 13.6513 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 513.401 | Positive charged surface: 277.748 | Negative charged surface: 235.653 | Volume: 280.375 | |||
| Hydrophobic surface: 304.81 | Hydrophilic surface: 208.591 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
