 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cccc1C(Nc1cc(ccc1)C(=O)[O-])C(=O)NCC1OCCC1 |
| InChI: | InChI=1/C18H20N2O4S/c21-17(19-11-14-6-2-8-24-14)16(15-7-3-9-25-15)20-13-5-1-4-12(10-13)18(22)23/h1,3-5,7,9-10,14,16,20H,2,6,8,11H2,(H,19,21)(H,22,23)/p-1/t14-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=73.4756 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 359.426 g/mol | logS: -3.85335 | SlogP: 1.6555 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0957901 | Sterimol/B1: 2.40375 | Sterimol/B2: 5.01499 | Sterimol/B3: 5.78619 | |||
| Sterimol/B4: 6.94779 | Sterimol/L: 17.3507 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 625.165 | Positive charged surface: 352.386 | Negative charged surface: 272.779 | Volume: 332.625 | |||
| Hydrophobic surface: 478.653 | Hydrophilic surface: 146.512 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
