 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CNC(=O)c1cc(NC(=O)c2c3c(ccc2)cccc3)ccc1N1CCC(CC1)C |
| InChI: | InChI=1/C29H33N3O3/c1-20-13-15-32(16-14-20)27-12-11-22(18-26(27)28(33)30-19-23-8-5-17-35-23)31-29(34)25-10-4-7-21-6-2-3-9-24(21)25/h2-4,6-7,9-12,18,20,23H,5,8,13-17,19H2,1H3,(H,30,33)(H,31,34)/t23-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=186.387 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 471.601 g/mol | logS: -7.27068 | SlogP: 5.2372 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0576056 | Sterimol/B1: 2.10558 | Sterimol/B2: 3.63733 | Sterimol/B3: 3.96223 | |||
| Sterimol/B4: 13.6487 | Sterimol/L: 18.9698 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 805.244 | Positive charged surface: 561.756 | Negative charged surface: 233.181 | Volume: 469.75 | |||
| Hydrophobic surface: 713.528 | Hydrophilic surface: 91.716 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.