Type: Neutral
Formula: C18H19F3N2O3
SMILES: |
FC(F)(F)c1cc(NC(=O)N(CC2OCCC2)Cc2occc2)ccc1 |
InChI: |
InChI=1/C18H19F3N2O3/c19-18(20,21)13-4-1-5-14(10-13)22-17(24)23(11-15-6-2-8-25-15)12-16-7-3-9-26-16/h1-2,4-6,8,10,16H,3,7,9,11-12H2,(H,22,24)/t16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 368.355 g/mol | logS: -4.59324 | SlogP: 5.0894 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.163179 | Sterimol/B1: 2.61191 | Sterimol/B2: 4.98117 | Sterimol/B3: 6.09326 |
Sterimol/B4: 7.70841 | Sterimol/L: 14.0021 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 601.261 | Positive charged surface: 328.558 | Negative charged surface: 272.703 | Volume: 324.125 |
Hydrophobic surface: 464.756 | Hydrophilic surface: 136.505 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |