Type: Neutral
Formula: C18H25NO6
SMILES: |
O1C2C(OC(OC2)(C)C)C(O)C(NC(=O)C)C1Oc1cc(ccc1)C |
InChI: |
InChI=1/C18H25NO6/c1-10-6-5-7-12(8-10)23-17-14(19-11(2)20)15(21)16-13(24-17)9-22-18(3,4)25-16/h5-8,13-17,21H,9H2,1-4H3,(H,19,20)/t13-,14+,15+,16-,17+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 351.399 g/mol | logS: -3.20328 | SlogP: 1.11582 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.162567 | Sterimol/B1: 3.72407 | Sterimol/B2: 4.42276 | Sterimol/B3: 5.08871 |
Sterimol/B4: 8.34033 | Sterimol/L: 14.4103 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 606.978 | Positive charged surface: 401.307 | Negative charged surface: 205.671 | Volume: 331.25 |
Hydrophobic surface: 473.221 | Hydrophilic surface: 133.757 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |