 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)([O-])=[NH])C(C(CC)C)C |
| InChI: | InChI=1/C13H19ClN3O4S2/c1-4-7(2)8(3)13-16-10-5-9(14)11(22(15,18)19)6-12(10)23(20,21)17-13/h5-8,13,16-17H,4H2,1-3H3,(H-,15,18,19)/q-1/t7-,8-,13-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-8.82051 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 380.897 g/mol | logS: -4.31059 | SlogP: 2.0237 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.103178 | Sterimol/B1: 3.1305 | Sterimol/B2: 3.82779 | Sterimol/B3: 4.64421 | |||
| Sterimol/B4: 5.25645 | Sterimol/L: 15.7834 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 552.616 | Positive charged surface: 254.781 | Negative charged surface: 297.835 | Volume: 311.75 | |||
| Hydrophobic surface: 298.745 | Hydrophilic surface: 253.871 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
