Type: Neutral
Formula: C21H28O3
SMILES: |
O=C1CCC2(C3C(C4CC=C(C(=O)CO)C4(CC3)C)CCC2=C1)C |
InChI: |
InChI=1/C21H28O3/c1-20-9-7-14(23)11-13(20)3-4-15-16-5-6-18(19(24)12-22)21(16,2)10-8-17(15)20/h6,11,15-17,22H,3-5,7-10,12H2,1-2H3/t15-,16+,17+,20+,21-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 328.452 g/mol | logS: -5.72316 | SlogP: 3.616 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.119092 | Sterimol/B1: 2.41893 | Sterimol/B2: 2.50396 | Sterimol/B3: 4.92301 |
Sterimol/B4: 5.7691 | Sterimol/L: 16.6531 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 524.851 | Positive charged surface: 352.576 | Negative charged surface: 172.275 | Volume: 324.625 |
Hydrophobic surface: 359.063 | Hydrophilic surface: 165.788 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |