Type: Neutral
Formula: C12H17N3O6
SMILES: |
O=C1NC(=O)N(C=C1C(=O)NC(OCC)=O)C(CC)CO |
InChI: |
InChI=1/C12H17N3O6/c1-3-7(6-16)15-5-8(9(17)13-11(15)19)10(18)14-12(20)21-4-2/h5,7,16H,3-4,6H2,1-2H3,(H,13,17,19)(H,14,18,20)/t7-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 299.283 g/mol | logS: -1.607 | SlogP: -0.5343 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0824082 | Sterimol/B1: 2.40788 | Sterimol/B2: 4.06832 | Sterimol/B3: 4.73604 |
Sterimol/B4: 6.1012 | Sterimol/L: 15.9158 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 529.032 | Positive charged surface: 362.328 | Negative charged surface: 166.703 | Volume: 261.125 |
Hydrophobic surface: 249.921 | Hydrophilic surface: 279.111 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |