Type: Neutral
Formula: C14H18O4
SMILES: |
O(C(=O)c1ccccc1OC)C1CCCCC1O |
InChI: |
InChI=1/C14H18O4/c1-17-12-8-4-2-6-10(12)14(16)18-13-9-5-3-7-11(13)15/h2,4,6,8,11,13,15H,3,5,7,9H2,1H3/t11-,13+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 250.294 g/mol | logS: -2.57037 | SlogP: 2.1555 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0597028 | Sterimol/B1: 2.54004 | Sterimol/B2: 2.97784 | Sterimol/B3: 3.75421 |
Sterimol/B4: 7.34437 | Sterimol/L: 13.9414 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 485.722 | Positive charged surface: 357.155 | Negative charged surface: 128.566 | Volume: 245.625 |
Hydrophobic surface: 419.797 | Hydrophilic surface: 65.925 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |