Type: Neutral
Formula: C19H22N4O2
SMILES: |
O=C(N1CC(CCC1)C(=O)NCc1ccccc1)c1ncc(nc1)C |
InChI: |
InChI=1/C19H22N4O2/c1-14-10-21-17(12-20-14)19(25)23-9-5-8-16(13-23)18(24)22-11-15-6-3-2-4-7-15/h2-4,6-7,10,12,16H,5,8-9,11,13H2,1H3,(H,22,24)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.411 g/mol | logS: -1.62438 | SlogP: 2.22002 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0413394 | Sterimol/B1: 3.19456 | Sterimol/B2: 3.49771 | Sterimol/B3: 3.79853 |
Sterimol/B4: 6.73775 | Sterimol/L: 18.2147 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 620.101 | Positive charged surface: 434.988 | Negative charged surface: 185.113 | Volume: 330.875 |
Hydrophobic surface: 523.806 | Hydrophilic surface: 96.295 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |