Type: Neutral
Formula: C18H21N3O2S
SMILES: |
s1ccnc1NC(=O)CN(C(=O)c1ccccc1)C1CCCCC1 |
InChI: |
InChI=1/C18H21N3O2S/c22-16(20-18-19-11-12-24-18)13-21(15-9-5-2-6-10-15)17(23)14-7-3-1-4-8-14/h1,3-4,7-8,11-12,15H,2,5-6,9-10,13H2,(H,19,20,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 343.451 g/mol | logS: -4.36396 | SlogP: 3.5567 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.219886 | Sterimol/B1: 3.11935 | Sterimol/B2: 3.19308 | Sterimol/B3: 5.76865 |
Sterimol/B4: 7.83579 | Sterimol/L: 14.8366 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 558.667 | Positive charged surface: 355.101 | Negative charged surface: 203.566 | Volume: 317.375 |
Hydrophobic surface: 463.258 | Hydrophilic surface: 95.409 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |