Type: Neutral
Formula: C19H25ClN2O
SMILES: |
ClC12CC3(CC(C1)CC(C3)C2)c1ccc(NC(=O)NCC)cc1 |
InChI: |
InChI=1/C19H25ClN2O/c1-2-21-17(23)22-16-5-3-15(4-6-16)18-8-13-7-14(9-18)11-19(20,10-13)12-18/h3-6,13-14H,2,7-12H2,1H3,(H2,21,22,23)/t13-,14+,18+,19- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 332.875 g/mol | logS: -5.05498 | SlogP: 5.0771 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0574715 | Sterimol/B1: 4.02928 | Sterimol/B2: 4.0324 | Sterimol/B3: 4.30657 |
Sterimol/B4: 4.57133 | Sterimol/L: 17.621 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 572.416 | Positive charged surface: 385.917 | Negative charged surface: 186.498 | Volume: 320 |
Hydrophobic surface: 422.844 | Hydrophilic surface: 149.572 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |