Type: Neutral
Formula: C12H16N4O5
SMILES: |
O=C1NC(=O)NC(CO)C1(CC=1NC(=O)NC(=O)C=1C)C |
InChI: |
InChI=1/C12H16N4O5/c1-5-6(13-10(20)15-8(5)18)3-12(2)7(4-17)14-11(21)16-9(12)19/h7,17H,3-4H2,1-2H3,(H2,13,15,18,20)(H2,14,16,19,21)/t7-,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 296.283 g/mol | logS: -0.91637 | SlogP: -1.3035 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.22757 | Sterimol/B1: 2.15286 | Sterimol/B2: 3.85954 | Sterimol/B3: 4.10268 |
Sterimol/B4: 6.88719 | Sterimol/L: 11.9175 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 449.089 | Positive charged surface: 269.071 | Negative charged surface: 180.018 | Volume: 246.375 |
Hydrophobic surface: 136.673 | Hydrophilic surface: 312.416 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |