Type: Neutral
Formula: C20H19FN2O
SMILES: |
Fc1ccc(NC(=O)Cn2c3CCCCc3c3c2cccc3)cc1 |
InChI: |
InChI=1/C20H19FN2O/c21-14-9-11-15(12-10-14)22-20(24)13-23-18-7-3-1-5-16(18)17-6-2-4-8-19(17)23/h1,3,5,7,9-12H,2,4,6,8,13H2,(H,22,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 322.383 g/mol | logS: -4.94901 | SlogP: 4.56424 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.111483 | Sterimol/B1: 2.75882 | Sterimol/B2: 3.54794 | Sterimol/B3: 4.21793 |
Sterimol/B4: 9.10037 | Sterimol/L: 14.867 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 567.561 | Positive charged surface: 352.905 | Negative charged surface: 208.814 | Volume: 312.375 |
Hydrophobic surface: 533.719 | Hydrophilic surface: 33.842 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |