Type: Ionized
Formula: C8H8N5O4S-
SMILES: |
S=C(NC1=CNC(=O)NC1=O)NNC(C(=O)[O-])=C |
InChI: |
InChI=1/C8H9N5O4S/c1-3(6(15)16)12-13-8(18)10-4-2-9-7(17)11-5(4)14/h2,12H,1H2,(H,15,16)(H2,10,13,18)(H2,9,11,14,17)/p-1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 270.249 g/mol | logS: -2.04282 | SlogP: -3.1005 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0856296 | Sterimol/B1: 2.12553 | Sterimol/B2: 3.91322 | Sterimol/B3: 5.25059 |
Sterimol/B4: 5.83992 | Sterimol/L: 13.0643 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 451.63 | Positive charged surface: 202.192 | Negative charged surface: 249.437 | Volume: 214 |
Hydrophobic surface: 77.9469 | Hydrophilic surface: 373.6831 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|