 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(N1CCc2c1cccc2)C(n1ccnc1)CC(=O)NCC(C[NH+](CC)CC)C |
| InChI: | InChI=1/C23H33N5O2/c1-4-26(5-2)16-18(3)15-25-22(29)14-21(27-13-11-24-17-27)23(30)28-12-10-19-8-6-7-9-20(19)28/h6-9,11,13,17-18,21H,4-5,10,12,14-16H2,1-3H3,(H,25,29)/p+1/t18-,21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=44.5637 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 412.558 g/mol | logS: -2.94337 | SlogP: 1.17607 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0501963 | Sterimol/B1: 2.43034 | Sterimol/B2: 3.91462 | Sterimol/B3: 4.65076 | |||
| Sterimol/B4: 7.03672 | Sterimol/L: 21.957 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 733.76 | Positive charged surface: 535.877 | Negative charged surface: 197.883 | Volume: 430.125 | |||
| Hydrophobic surface: 578.819 | Hydrophilic surface: 154.941 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
